C10H17ClN2O3 — CID 70404893
(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;methanamine;hydrochloride (PubChem CID 70404893) has the molecular formula C10H17ClN2O3 and a molecular weight of 248.71 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;methanamine;hydrochloride.
| Compound Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;methanamine;hydrochloride |
|---|---|
| PubChem CID | 70404893 |
| Molecular Formula | C10H17ClN2O3 |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;methanamine;hydrochloride |
| SMILES | CN.Cl.N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C9H11NO3.CH5N.ClH/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;1-2;/h1-4,8,11H,5,10H2,(H,12,13);2H2,1H3;1H/t8-;;/m0../s1 |
| InChIKey | OWDFXVWVXXJBJU-JZGIKJSDSA-N |
| XLogP | 0.34 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |