C11H17NO4S — CID 70446707
(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;methylsulfinylmethane (PubChem CID 70446707) has the molecular formula C11H17NO4S and a molecular weight of 259.33 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;methylsulfinylmethane.
| Compound Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;methylsulfinylmethane |
|---|---|
| PubChem CID | 70446707 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;methylsulfinylmethane |
| SMILES | CS(C)=O.N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C9H11NO3.C2H6OS/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;1-4(2)3/h1-4,8,11H,5,10H2,(H,12,13);1-2H3/t8-;/m0./s1 |
| InChIKey | ATBBQCGYZUUQPX-QRPNPIFTSA-N |
| XLogP | 0.34 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |