C9H14AsNO7 — CID 87073128
(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;arsoric acid (PubChem CID 87073128) has the molecular formula C9H14AsNO7 and a molecular weight of 323.13 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;arsoric acid.
| Compound Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;arsoric acid |
|---|---|
| PubChem CID | 87073128 |
| Molecular Formula | C9H14AsNO7 |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;arsoric acid |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)O.O=[As](O)(O)O |
| InChI | InChI=1S/C9H11NO3.AsH3O4/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;2-1(3,4)5/h1-4,8,11H,5,10H2,(H,12,13);(H3,2,3,4,5)/t8-;/m0./s1 |
| InChIKey | MPBRFTJVJJKEHZ-QRPNPIFTSA-N |
| XLogP | -1.82 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|