C10H14N2O3S2 — CID 174727154
(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;carbamodithioic acid (PubChem CID 174727154) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;carbamodithioic acid.
| Compound Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;carbamodithioic acid |
|---|---|
| PubChem CID | 174727154 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;carbamodithioic acid |
| SMILES | NC(=S)S.N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C9H11NO3.CH3NS2/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;2-1(3)4/h1-4,8,11H,5,10H2,(H,12,13);(H3,2,3,4)/t8-;/m0./s1 |
| InChIKey | SMVOGZOSUFRWFP-QRPNPIFTSA-N |
| XLogP | 0.51 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|