C27H35N5O7 — CID 67902185
bis(2-amino-3-(4-hydroxyphenyl)propanamide);2-amino-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 67902185) has the molecular formula C27H35N5O7 and a molecular weight of 541.61 g/mol. Its IUPAC name is bis(2-amino-3-(4-hydroxyphenyl)propanamide);2-amino-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | bis(2-amino-3-(4-hydroxyphenyl)propanamide);2-amino-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 67902185 |
| Molecular Formula | C27H35N5O7 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | bis(2-amino-3-(4-hydroxyphenyl)propanamide);2-amino-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NC(=O)C(N)Cc1ccc(O)cc1.NC(=O)C(N)Cc1ccc(O)cc1.NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/2C9H12N2O2.C9H11NO3/c2*10-8(9(11)13)5-6-1-3-7(12)4-2-6;10-8(9(12)13)5-6-1-3-7(11)4-2-6/h2*1-4,8,12H,5,10H2,(H2,11,13);1-4,8,11H,5,10H2,(H,12,13) |
| InChIKey | MHWADXKMHLSPDR-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 262.23 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |