C21H29N3O8S — CID 146277960
bis(2-amino-3-(4-hydroxyphenyl)propanoic acid);2-amino-3-sulfanylpropanoic acid (PubChem CID 146277960) has the molecular formula C21H29N3O8S and a molecular weight of 483.54 g/mol. Its IUPAC name is bis(2-amino-3-(4-hydroxyphenyl)propanoic acid);2-amino-3-sulfanylpropanoic acid.
| Compound Name | bis(2-amino-3-(4-hydroxyphenyl)propanoic acid);2-amino-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 146277960 |
| Molecular Formula | C21H29N3O8S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | bis(2-amino-3-(4-hydroxyphenyl)propanoic acid);2-amino-3-sulfanylpropanoic acid |
| SMILES | NC(CS)C(=O)O.NC(Cc1ccc(O)cc1)C(=O)O.NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/2C9H11NO3.C3H7NO2S/c2*10-8(9(12)13)5-6-1-3-7(11)4-2-6;4-2(1-7)3(5)6/h2*1-4,8,11H,5,10H2,(H,12,13);2,7H,1,4H2,(H,5,6) |
| InChIKey | IJNLTPXQMZLPSV-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 230.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|