C15H27N3O2 — CID 172689330
deuterio (2S)-2,6-diaminohexanoate;1-phenylpropan-2-amine (PubChem CID 172689330) has the molecular formula C15H27N3O2 and a molecular weight of 282.41 g/mol. Its IUPAC name is deuterio (2S)-2,6-diaminohexanoate;1-phenylpropan-2-amine.
| Compound Name | deuterio (2S)-2,6-diaminohexanoate;1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 172689330 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | deuterio (2S)-2,6-diaminohexanoate;1-phenylpropan-2-amine |
| SMILES | CC(N)Cc1ccccc1.[2H]OC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C9H13N.C6H14N2O2/c1-8(10)7-9-5-3-2-4-6-9;7-4-2-1-3-5(8)6(9)10/h2-6,8H,7,10H2,1H3;5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1/i/hD |
| InChIKey | BLQWGCDGGXGQLQ-MNGJLQTBSA-N |
| XLogP | 1.10 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|