C16H24N2O3 — CID 14542143
(5S)-5,9-diamino-2-benzyl-4-oxononanoic acid (PubChem CID 14542143) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (5S)-5,9-diamino-2-benzyl-4-oxononanoic acid.
| Compound Name | (5S)-5,9-diamino-2-benzyl-4-oxononanoic acid |
|---|---|
| PubChem CID | 14542143 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (5S)-5,9-diamino-2-benzyl-4-oxononanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)CC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H24N2O3/c17-9-5-4-8-14(18)15(19)11-13(16(20)21)10-12-6-2-1-3-7-12/h1-3,6-7,13-14H,4-5,8-11,17-18H2,(H,20,21)/t13?,14-/m0/s1 |
| InChIKey | LIJBAQFOQWDLOJ-KZUDCZAMSA-N |
| XLogP | 1.35 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|