C15H24FN3O4 — CID 87770950
2,6-diaminohexanoic acid;2-(fluoroamino)-3-phenylpropanoic acid (PubChem CID 87770950) has the molecular formula C15H24FN3O4 and a molecular weight of 329.37 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;2-(fluoroamino)-3-phenylpropanoic acid.
| Compound Name | 2,6-diaminohexanoic acid;2-(fluoroamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 87770950 |
| Molecular Formula | C15H24FN3O4 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 2,6-diaminohexanoic acid;2-(fluoroamino)-3-phenylpropanoic acid |
| SMILES | NCCCCC(N)C(=O)O.O=C(O)C(Cc1ccccc1)NF |
| InChI | InChI=1S/C9H10FNO2.C6H14N2O2/c10-11-8(9(12)13)6-7-4-2-1-3-5-7;7-4-2-1-3-5(8)6(9)10/h1-5,8,11H,6H2,(H,12,13);5H,1-4,7-8H2,(H,9,10) |
| InChIKey | DERWRAGNSATSRH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|