C20H30N4O6 — CID 25051339
(2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-phenylpropanoyl]amino]pentanedioic acid (PubChem CID 25051339) has the molecular formula C20H30N4O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-phenylpropanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-phenylpropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 25051339 |
| Molecular Formula | C20H30N4O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-phenylpropanoyl]amino]pentanedioic acid |
| SMILES | NCCCC[C@H](N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H30N4O6/c21-11-5-4-8-14(22)18(27)24-16(12-13-6-2-1-3-7-13)19(28)23-15(20(29)30)9-10-17(25)26/h1-3,6-7,14-16H,4-5,8-12,21-22H2,(H,23,28)(H,24,27)(H,25,26)(H,29,30)/t14-,15-,16-/m0/s1 |
| InChIKey | ZJSZPXISKMDJKQ-JYJNAYRXSA-N |
| XLogP | -0.40 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|