C23H33N5O9 — CID 18303575
4-[[3-carboxy-1-[(1-carboxy-2-phenylethyl)amino]-1-oxopropan-2-yl]amino]-3-(2,6-diaminohexanoylamino)-4-oxobutanoic acid (PubChem CID 18303575) has the molecular formula C23H33N5O9 and a molecular weight of 523.54 g/mol. Its IUPAC name is 4-[[3-carboxy-1-[(1-carboxy-2-phenylethyl)amino]-1-oxopropan-2-yl]amino]-3-(2,6-diaminohexanoylamino)-4-oxobutanoic acid.
| Compound Name | 4-[[3-carboxy-1-[(1-carboxy-2-phenylethyl)amino]-1-oxopropan-2-yl]amino]-3-(2,6-diaminohexanoylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18303575 |
| Molecular Formula | C23H33N5O9 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 4-[[3-carboxy-1-[(1-carboxy-2-phenylethyl)amino]-1-oxopropan-2-yl]amino]-3-(2,6-diaminohexanoylamino)-4-oxobutanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H33N5O9/c24-9-5-4-8-14(25)20(33)26-15(11-18(29)30)21(34)27-16(12-19(31)32)22(35)28-17(23(36)37)10-13-6-2-1-3-7-13/h1-3,6-7,14-17H,4-5,8-12,24-25H2,(H,26,33)(H,27,34)(H,28,35)(H,29,30)(H,31,32)(H,36,37) |
| InChIKey | AGIAQFIUDDXJKQ-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 251.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|