C24H37N5O7S — CID 18307123
4-[(1-carboxy-2-phenylethyl)amino]-3-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-4-oxobutanoic acid (PubChem CID 18307123) has the molecular formula C24H37N5O7S and a molecular weight of 539.66 g/mol. Its IUPAC name is 4-[(1-carboxy-2-phenylethyl)amino]-3-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[(1-carboxy-2-phenylethyl)amino]-3-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18307123 |
| Molecular Formula | C24H37N5O7S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 4-[(1-carboxy-2-phenylethyl)amino]-3-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-4-oxobutanoic acid |
| SMILES | CSCCC(NC(=O)C(N)CCCCN)C(=O)NC(CC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H37N5O7S/c1-37-12-10-17(27-21(32)16(26)9-5-6-11-25)22(33)28-18(14-20(30)31)23(34)29-19(24(35)36)13-15-7-3-2-4-8-15/h2-4,7-8,16-19H,5-6,9-14,25-26H2,1H3,(H,27,32)(H,28,33)(H,29,34)(H,30,31)(H,35,36) |
| InChIKey | KDWCSSXCQQNTCU-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|