C25H39N5O7 — CID 18298816
3-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-4-[(1-carboxy-2-phenylethyl)amino]-4-oxobutanoic acid (PubChem CID 18298816) has the molecular formula C25H39N5O7 and a molecular weight of 521.62 g/mol. Its IUPAC name is 3-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-4-[(1-carboxy-2-phenylethyl)amino]-4-oxobutanoic acid.
| Compound Name | 3-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-4-[(1-carboxy-2-phenylethyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18298816 |
| Molecular Formula | C25H39N5O7 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 3-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-4-[(1-carboxy-2-phenylethyl)amino]-4-oxobutanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CCCCN)C(=O)NC(CC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H39N5O7/c1-15(2)12-17(27)22(33)28-18(10-6-7-11-26)23(34)29-19(14-21(31)32)24(35)30-20(25(36)37)13-16-8-4-3-5-9-16/h3-5,8-9,15,17-20H,6-7,10-14,26-27H2,1-2H3,(H,28,33)(H,29,34)(H,30,35)(H,31,32)(H,36,37) |
| InChIKey | JVBOGHYMILCTLN-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|