C24H39N5O5 — CID 22702721
6-amino-2-[[2-[2-[(2-amino-4-methylpentanoyl)amino]propanoylamino]-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 22702721) has the molecular formula C24H39N5O5 and a molecular weight of 477.61 g/mol. Its IUPAC name is 6-amino-2-[[2-[2-[(2-amino-4-methylpentanoyl)amino]propanoylamino]-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[2-[(2-amino-4-methylpentanoyl)amino]propanoylamino]-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22702721 |
| Molecular Formula | C24H39N5O5 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 6-amino-2-[[2-[2-[(2-amino-4-methylpentanoyl)amino]propanoylamino]-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(C)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C24H39N5O5/c1-15(2)13-18(26)22(31)27-16(3)21(30)29-20(14-17-9-5-4-6-10-17)23(32)28-19(24(33)34)11-7-8-12-25/h4-6,9-10,15-16,18-20H,7-8,11-14,25-26H2,1-3H3,(H,27,31)(H,28,32)(H,29,30)(H,33,34) |
| InChIKey | IZZBDXCOMNJTIC-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|