C21H41N5O5 — CID 22706427
6-amino-2-[2-[[2-[(2-amino-4-methylpentanoyl)amino]-4-methylpentanoyl]amino]propanoylamino]hexanoic acid (PubChem CID 22706427) has the molecular formula C21H41N5O5 and a molecular weight of 443.59 g/mol. Its IUPAC name is 6-amino-2-[2-[[2-[(2-amino-4-methylpentanoyl)amino]-4-methylpentanoyl]amino]propanoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[2-[[2-[(2-amino-4-methylpentanoyl)amino]-4-methylpentanoyl]amino]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 22706427 |
| Molecular Formula | C21H41N5O5 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.31 |
| IUPAC Name | 6-amino-2-[2-[[2-[(2-amino-4-methylpentanoyl)amino]-4-methylpentanoyl]amino]propanoylamino]hexanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CC(C)C)C(=O)NC(C)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C21H41N5O5/c1-12(2)10-15(23)19(28)26-17(11-13(3)4)20(29)24-14(5)18(27)25-16(21(30)31)8-6-7-9-22/h12-17H,6-11,22-23H2,1-5H3,(H,24,29)(H,25,27)(H,26,28)(H,30,31) |
| InChIKey | XMVORMMQHLWQPL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|