C24H48N6O5 — CID 18306476
6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid (PubChem CID 18306476) has the molecular formula C24H48N6O5 and a molecular weight of 500.69 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18306476 |
| Molecular Formula | C24H48N6O5 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.37 |
| IUPAC Name | 6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCCCN)C(=O)NC(CC(C)C)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C24H48N6O5/c1-15(2)13-19(29-21(31)17(27)9-5-7-11-25)23(33)30-20(14-16(3)4)22(32)28-18(24(34)35)10-6-8-12-26/h15-20H,5-14,25-27H2,1-4H3,(H,28,32)(H,29,31)(H,30,33)(H,34,35) |
| InChIKey | SYGUJSYRPRIQDI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 202.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|