C12H25N3O3 — CID 4682588
2-(2,6-diaminohexanoylamino)-4-methylpentanoic acid (PubChem CID 4682588) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-(2,6-diaminohexanoylamino)-4-methylpentanoic acid.
| Compound Name | 2-(2,6-diaminohexanoylamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 4682588 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-(2,6-diaminohexanoylamino)-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C12H25N3O3/c1-8(2)7-10(12(17)18)15-11(16)9(14)5-3-4-6-13/h8-10H,3-7,13-14H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | ATIPDCIQTUXABX-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|