C22H43N5O6 — CID 18308854
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoic acid (PubChem CID 18308854) has the molecular formula C22H43N5O6 and a molecular weight of 473.62 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18308854 |
| Molecular Formula | C22H43N5O6 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.32 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(N)CCCCN)C(C)O)C(=O)O |
| InChI | InChI=1S/C22H43N5O6/c1-12(2)10-16(20(30)26-17(22(32)33)11-13(3)4)25-21(31)18(14(5)28)27-19(29)15(24)8-6-7-9-23/h12-18,28H,6-11,23-24H2,1-5H3,(H,25,31)(H,26,30)(H,27,29)(H,32,33) |
| InChIKey | XNXRJNFRTXQBPU-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|