C13H26N4O6 — CID 145456786
(2S)-2-[[(2S,3R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 145456786) has the molecular formula C13H26N4O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is (2S)-2-[[(2S,3R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(2S,3R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 145456786 |
| Molecular Formula | C13H26N4O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (2S)-2-[[(2S,3R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C13H26N4O6/c1-7(19)10(12(21)16-9(6-18)13(22)23)17-11(20)8(15)4-2-3-5-14/h7-10,18-19H,2-6,14-15H2,1H3,(H,16,21)(H,17,20)(H,22,23)/t7-,8+,9+,10+/m1/s1 |
| InChIKey | RMOKGALPSPOYKE-KATARQTJSA-N |
| XLogP | -3.13 |
| TPSA | 188.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|