C16H31N5O7 — CID 18239240
6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid (PubChem CID 18239240) has the molecular formula C16H31N5O7 and a molecular weight of 405.45 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18239240 |
| Molecular Formula | C16H31N5O7 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid |
| SMILES | CC(N)C(=O)NC(C(=O)NC(CO)C(=O)NC(CCCCN)C(=O)O)C(C)O |
| InChI | InChI=1S/C16H31N5O7/c1-8(18)13(24)21-12(9(2)23)15(26)20-11(7-22)14(25)19-10(16(27)28)5-3-4-6-17/h8-12,22-23H,3-7,17-18H2,1-2H3,(H,19,25)(H,20,26)(H,21,24)(H,27,28) |
| InChIKey | MVMKPKKORPAOHK-UHFFFAOYSA-N |
| XLogP | -3.63 |
| TPSA | 217.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|