C17H31N5O8 — CID 18239152
2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]hexanoyl]amino]butanedioic acid (PubChem CID 18239152) has the molecular formula C17H31N5O8 and a molecular weight of 433.46 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]hexanoyl]amino]butanedioic acid.
| Compound Name | 2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]hexanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18239152 |
| Molecular Formula | C17H31N5O8 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]hexanoyl]amino]butanedioic acid |
| SMILES | CC(N)C(=O)NC(C(=O)NC(CCCCN)C(=O)NC(CC(=O)O)C(=O)O)C(C)O |
| InChI | InChI=1S/C17H31N5O8/c1-8(19)14(26)22-13(9(2)23)16(28)20-10(5-3-4-6-18)15(27)21-11(17(29)30)7-12(24)25/h8-11,13,23H,3-7,18-19H2,1-2H3,(H,20,28)(H,21,27)(H,22,26)(H,24,25)(H,29,30) |
| InChIKey | BNOSSDLKASAPIH-UHFFFAOYSA-N |
| XLogP | -3.14 |
| TPSA | 234.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|