C13H24N4O6 — CID 18218444
2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]butanedioic acid (PubChem CID 18218444) has the molecular formula C13H24N4O6 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]butanedioic acid.
| Compound Name | 2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18218444 |
| Molecular Formula | C13H24N4O6 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]butanedioic acid |
| SMILES | CC(N)C(=O)NC(CCCCN)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H24N4O6/c1-7(15)11(20)16-8(4-2-3-5-14)12(21)17-9(13(22)23)6-10(18)19/h7-9H,2-6,14-15H2,1H3,(H,16,20)(H,17,21)(H,18,19)(H,22,23) |
| InChIKey | SDZRIBWEVVRDQI-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|