C20H38N6O7 — CID 18237051
6-amino-2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 18237051) has the molecular formula C20H38N6O7 and a molecular weight of 474.56 g/mol. Its IUPAC name is 6-amino-2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18237051 |
| Molecular Formula | C20H38N6O7 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | 6-amino-2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | CC(N)C(=O)NC(CCCCN)C(=O)NC(CCC(=O)O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C20H38N6O7/c1-12(23)17(29)24-13(6-2-4-10-21)18(30)25-14(8-9-16(27)28)19(31)26-15(20(32)33)7-3-5-11-22/h12-15H,2-11,21-23H2,1H3,(H,24,29)(H,25,30)(H,26,31)(H,27,28)(H,32,33) |
| InChIKey | KFRCZRIQHOTRIM-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|