C21H40N6O8 — CID 18749600
6-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 18749600) has the molecular formula C21H40N6O8 and a molecular weight of 504.59 g/mol. Its IUPAC name is 6-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18749600 |
| Molecular Formula | C21H40N6O8 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | 6-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCCCN)C(=O)NC(CCC(=O)O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C21H40N6O8/c1-12(28)17(24)20(33)26-13(6-2-4-10-22)18(31)25-14(8-9-16(29)30)19(32)27-15(21(34)35)7-3-5-11-23/h12-15,17,28H,2-11,22-24H2,1H3,(H,25,31)(H,26,33)(H,27,32)(H,29,30)(H,34,35) |
| InChIKey | OINJOQBHDWUQKU-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 260.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|