C19H35N5O9 — CID 18747423
6-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid (PubChem CID 18747423) has the molecular formula C19H35N5O9 and a molecular weight of 477.52 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18747423 |
| Molecular Formula | C19H35N5O9 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCC(=O)O)C(=O)NC(C(=O)NC(CCCCN)C(=O)O)C(C)O |
| InChI | InChI=1S/C19H35N5O9/c1-9(25)14(21)17(30)22-11(6-7-13(27)28)16(29)24-15(10(2)26)18(31)23-12(19(32)33)5-3-4-8-20/h9-12,14-15,25-26H,3-8,20-21H2,1-2H3,(H,22,30)(H,23,31)(H,24,29)(H,27,28)(H,32,33) |
| InChIKey | UUSQINPTPSBESU-UHFFFAOYSA-N |
| XLogP | -3.39 |
| TPSA | 254.40 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|