C20H35N5O10 — CID 18304614
2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid (PubChem CID 18304614) has the molecular formula C20H35N5O10 and a molecular weight of 505.53 g/mol. Its IUPAC name is 2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18304614 |
| Molecular Formula | C20H35N5O10 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid |
| SMILES | CC(O)C(NC(=O)C(CCC(=O)O)NC(=O)C(N)CCCCN)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H35N5O10/c1-10(26)16(19(33)24-13(20(34)35)6-8-15(29)30)25-18(32)12(5-7-14(27)28)23-17(31)11(22)4-2-3-9-21/h10-13,16,26H,2-9,21-22H2,1H3,(H,23,31)(H,24,33)(H,25,32)(H,27,28)(H,29,30)(H,34,35) |
| InChIKey | YXXNASDZRZFZIW-UHFFFAOYSA-N |
| XLogP | -2.91 |
| TPSA | 271.47 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|