C18H33N5O8S — CID 18304223
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid (PubChem CID 18304223) has the molecular formula C18H33N5O8S and a molecular weight of 479.56 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18304223 |
| Molecular Formula | C18H33N5O8S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid |
| SMILES | CC(O)C(NC(=O)C(CS)NC(=O)C(N)CCCCN)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H33N5O8S/c1-9(24)14(17(29)21-11(18(30)31)5-6-13(25)26)23-16(28)12(8-32)22-15(27)10(20)4-2-3-7-19/h9-12,14,24,32H,2-8,19-20H2,1H3,(H,21,29)(H,22,27)(H,23,28)(H,25,26)(H,30,31) |
| InChIKey | WNSFPLXPGIGVTQ-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 234.17 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|