C20H38N6O7S — CID 18304009
6-amino-2-[[4-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]butanoyl]amino]hexanoic acid (PubChem CID 18304009) has the molecular formula C20H38N6O7S and a molecular weight of 506.63 g/mol. Its IUPAC name is 6-amino-2-[[4-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]butanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[4-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]butanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18304009 |
| Molecular Formula | C20H38N6O7S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 6-amino-2-[[4-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]butanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CS)C(=O)NC(CCC(=O)O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C20H38N6O7S/c21-9-3-1-5-12(23)17(29)26-15(11-34)19(31)24-13(7-8-16(27)28)18(30)25-14(20(32)33)6-2-4-10-22/h12-15,34H,1-11,21-23H2,(H,24,31)(H,25,30)(H,26,29)(H,27,28)(H,32,33) |
| InChIKey | GSDHRLYNKNAMGX-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|