C17H31N5O7S — CID 18304375
5-[[1-(1-carboxyethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid (PubChem CID 18304375) has the molecular formula C17H31N5O7S and a molecular weight of 449.53 g/mol. Its IUPAC name is 5-[[1-(1-carboxyethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid.
| Compound Name | 5-[[1-(1-carboxyethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18304375 |
| Molecular Formula | C17H31N5O7S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 5-[[1-(1-carboxyethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid |
| SMILES | CC(NC(=O)C(CS)NC(=O)C(CCC(=O)O)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C17H31N5O7S/c1-9(17(28)29)20-16(27)12(8-30)22-15(26)11(5-6-13(23)24)21-14(25)10(19)4-2-3-7-18/h9-12,30H,2-8,18-19H2,1H3,(H,20,27)(H,21,25)(H,22,26)(H,23,24)(H,28,29) |
| InChIKey | QNUDNGMYMHAGQX-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|