C16H29N5O7S — CID 18248320
3-amino-4-[[1-[[6-amino-1-(1-carboxyethylamino)-1-oxohexan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 18248320) has the molecular formula C16H29N5O7S and a molecular weight of 435.50 g/mol. Its IUPAC name is 3-amino-4-[[1-[[6-amino-1-(1-carboxyethylamino)-1-oxohexan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[1-[[6-amino-1-(1-carboxyethylamino)-1-oxohexan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18248320 |
| Molecular Formula | C16H29N5O7S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 3-amino-4-[[1-[[6-amino-1-(1-carboxyethylamino)-1-oxohexan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CC(NC(=O)C(CCCCN)NC(=O)C(CS)NC(=O)C(N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H29N5O7S/c1-8(16(27)28)19-14(25)10(4-2-3-5-17)20-15(26)11(7-29)21-13(24)9(18)6-12(22)23/h8-11,29H,2-7,17-18H2,1H3,(H,19,25)(H,20,26)(H,21,24)(H,22,23)(H,27,28) |
| InChIKey | MITXAFVDUJODNU-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|