C15H29N5O6S — CID 18260691
2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxypropanoyl]amino]hexanoyl]amino]propanoic acid (PubChem CID 18260691) has the molecular formula C15H29N5O6S and a molecular weight of 407.49 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxypropanoyl]amino]hexanoyl]amino]propanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxypropanoyl]amino]hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18260691 |
| Molecular Formula | C15H29N5O6S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxypropanoyl]amino]hexanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(CCCCN)NC(=O)C(CO)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C15H29N5O6S/c1-8(15(25)26)18-13(23)10(4-2-3-5-16)19-14(24)11(6-21)20-12(22)9(17)7-27/h8-11,21,27H,2-7,16-17H2,1H3,(H,18,23)(H,19,24)(H,20,22)(H,25,26) |
| InChIKey | FEEWBQRVHKSPCF-UHFFFAOYSA-N |
| XLogP | -3.08 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|