C18H36N8O5S — CID 18258894
2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid (PubChem CID 18258894) has the molecular formula C18H36N8O5S and a molecular weight of 476.60 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18258894 |
| Molecular Formula | C18H36N8O5S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(CCCN=C(N)N)NC(=O)C(CCCCN)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C18H36N8O5S/c1-10(17(30)31)24-15(28)13(6-4-8-23-18(21)22)26-16(29)12(5-2-3-7-19)25-14(27)11(20)9-32/h10-13,32H,2-9,19-20H2,1H3,(H,24,28)(H,25,27)(H,26,29)(H,30,31)(H4,21,22,23) |
| InChIKey | ZVVIGGXZGFNZNZ-UHFFFAOYSA-N |
| XLogP | -3.02 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|