C18H36N10O5S — CID 18240996
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid (PubChem CID 18240996) has the molecular formula C18H36N10O5S and a molecular weight of 504.62 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18240996 |
| Molecular Formula | C18H36N10O5S |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(CS)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C18H36N10O5S/c1-9(16(32)33)26-15(31)12(8-34)28-14(30)11(5-3-7-25-18(22)23)27-13(29)10(19)4-2-6-24-17(20)21/h9-12,34H,2-8,19H2,1H3,(H,26,31)(H,27,29)(H,28,30)(H,32,33)(H4,20,21,24)(H4,22,23,25) |
| InChIKey | ATPHUTYSLZZXQF-UHFFFAOYSA-N |
| XLogP | -4.09 |
| TPSA | 279.42 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|