C18H36N10O6S — CID 18242143
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18242143) has the molecular formula C18H36N10O6S and a molecular weight of 520.62 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18242143 |
| Molecular Formula | C18H36N10O6S |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CS)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C18H36N10O6S/c19-9(3-1-5-24-17(20)21)13(30)28-12(8-35)15(32)26-10(4-2-6-25-18(22)23)14(31)27-11(7-29)16(33)34/h9-12,29,35H,1-8,19H2,(H,26,32)(H,27,31)(H,28,30)(H,33,34)(H4,20,21,24)(H4,22,23,25) |
| InChIKey | SVSPCLUIHRVEJW-UHFFFAOYSA-N |
| XLogP | -5.12 |
| TPSA | 299.65 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | -5.12 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|