C16H30N8O7S — CID 18242163
2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18242163) has the molecular formula C16H30N8O7S and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18242163 |
| Molecular Formula | C16H30N8O7S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NC(=O)CC(NC(=O)C(CS)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C16H30N8O7S/c17-7(2-1-3-21-16(19)20)12(27)24-10(6-32)14(29)22-8(4-11(18)26)13(28)23-9(5-25)15(30)31/h7-10,25,32H,1-6,17H2,(H2,18,26)(H,22,29)(H,23,28)(H,24,27)(H,30,31)(H4,19,20,21) |
| InChIKey | SRSSGGOADPYVIY-UHFFFAOYSA-N |
| XLogP | -5.30 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | -5.30 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|