C17H29N7O9S — CID 18241792
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid (PubChem CID 18241792) has the molecular formula C17H29N7O9S and a molecular weight of 507.53 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18241792 |
| Molecular Formula | C17H29N7O9S |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CC(=O)O)C(=O)NC(CS)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H29N7O9S/c18-7(2-1-3-21-17(19)20)13(29)22-8(4-11(25)26)14(30)24-10(6-34)15(31)23-9(16(32)33)5-12(27)28/h7-10,34H,1-6,18H2,(H,22,29)(H,23,31)(H,24,30)(H,25,26)(H,27,28)(H,32,33)(H4,19,20,21) |
| InChIKey | PPKXCEALZOXSTI-UHFFFAOYSA-N |
| XLogP | -4.21 |
| TPSA | 289.62 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|