C16H30N8O6S2 — CID 175732313
(2R)-2-[[(2S)-4-amino-2-[[(2R)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 175732313) has the molecular formula C16H30N8O6S2 and a molecular weight of 494.60 g/mol. Its IUPAC name is (2R)-2-[[(2S)-4-amino-2-[[(2R)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2S)-4-amino-2-[[(2R)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 175732313 |
| Molecular Formula | C16H30N8O6S2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | (2R)-2-[[(2S)-4-amino-2-[[(2R)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NC(=O)C[C@H](NC(=O)[C@H](CS)NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C16H30N8O6S2/c17-7(2-1-3-21-16(19)20)12(26)23-9(5-31)14(28)22-8(4-11(18)25)13(27)24-10(6-32)15(29)30/h7-10,31-32H,1-6,17H2,(H2,18,25)(H,22,28)(H,23,26)(H,24,27)(H,29,30)(H4,19,20,21)/t7-,8-,9-,10-/m0/s1 |
| InChIKey | NMJNYJLTEPKSQS-XKNYDFJKSA-N |
| XLogP | -4.36 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|