C18H33N9O7S — CID 22701449
2-[[2-[[4-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 22701449) has the molecular formula C18H33N9O7S and a molecular weight of 519.59 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[4-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 22701449 |
| Molecular Formula | C18H33N9O7S |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 2-[[2-[[4-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)NC(CC(N)=O)C(=O)NC(CS)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C18H33N9O7S/c19-8(3-4-12(20)28)14(30)26-10(6-13(21)29)15(31)27-11(7-35)16(32)25-9(17(33)34)2-1-5-24-18(22)23/h8-11,35H,1-7,19H2,(H2,20,28)(H2,21,29)(H,25,32)(H,26,30)(H,27,31)(H,33,34)(H4,22,23,24) |
| InChIKey | QSUKHACSJXTJPH-UHFFFAOYSA-N |
| XLogP | -5.02 |
| TPSA | 301.20 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | -5.02 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|