C20H36N10O8 — CID 18479203
2-[[4-amino-2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18479203) has the molecular formula C20H36N10O8 and a molecular weight of 544.57 g/mol. Its IUPAC name is 2-[[4-amino-2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[4-amino-2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18479203 |
| Molecular Formula | C20H36N10O8 |
| Molecular Weight | 544.57 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | 2-[[4-amino-2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)NC(CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H36N10O8/c21-9(3-5-13(22)31)16(34)28-10(4-6-14(23)32)17(35)30-12(8-15(24)33)18(36)29-11(19(37)38)2-1-7-27-20(25)26/h9-12H,1-8,21H2,(H2,22,31)(H2,23,32)(H2,24,33)(H,28,34)(H,29,36)(H,30,35)(H,37,38)(H4,25,26,27) |
| InChIKey | KZBLITXMXQKWCZ-UHFFFAOYSA-N |
| XLogP | -5.69 |
| TPSA | 344.29 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.57 |
| LogP ≤ 5 | -5.69 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|