C21H39N11O8 — CID 18241410
4-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid (PubChem CID 18241410) has the molecular formula C21H39N11O8 and a molecular weight of 573.61 g/mol. Its IUPAC name is 4-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18241410 |
| Molecular Formula | C21H39N11O8 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | 4-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H39N11O8/c22-10(3-1-7-28-20(24)25)16(36)32-13(9-14(23)33)18(38)30-11(5-6-15(34)35)17(37)31-12(19(39)40)4-2-8-29-21(26)27/h10-13H,1-9,22H2,(H2,23,33)(H,30,38)(H,31,37)(H,32,36)(H,34,35)(H,39,40)(H4,24,25,28)(H4,26,27,29) |
| InChIKey | MTYATDVWADWNPV-UHFFFAOYSA-N |
| XLogP | -5.30 |
| TPSA | 359.81 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | -5.30 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|