C17H33N9O6 — CID 18218691
4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid (PubChem CID 18218691) has the molecular formula C17H33N9O6 and a molecular weight of 459.51 g/mol. Its IUPAC name is 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18218691 |
| Molecular Formula | C17H33N9O6 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C17H33N9O6/c18-9(3-1-7-23-16(19)20)13(29)25-10(5-6-12(27)28)14(30)26-11(15(31)32)4-2-8-24-17(21)22/h9-11H,1-8,18H2,(H,25,29)(H,26,30)(H,27,28)(H,31,32)(H4,19,20,23)(H4,21,22,24) |
| InChIKey | QAODJPUKWNNNRP-UHFFFAOYSA-N |
| XLogP | -3.66 |
| TPSA | 287.62 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|