C14H26N6O7 — CID 145453932
(2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid (PubChem CID 145453932) has the molecular formula C14H26N6O7 and a molecular weight of 390.40 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 145453932 |
| Molecular Formula | C14H26N6O7 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H26N6O7/c15-7(2-1-5-18-14(16)17)11(24)20-9(6-21)12(25)19-8(13(26)27)3-4-10(22)23/h7-9,21H,1-6,15H2,(H,19,25)(H,20,24)(H,22,23)(H,26,27)(H4,16,17,18)/t7-,8-,9-/m0/s1 |
| InChIKey | ISJWBVIYRBAXEB-CIUDSAMLSA-N |
| XLogP | -3.72 |
| TPSA | 243.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|