C19H34N8O9 — CID 18242813
5-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]-3-hydroxypropanoyl]amino]-5-oxopentanoic acid (PubChem CID 18242813) has the molecular formula C19H34N8O9 and a molecular weight of 518.53 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]-3-hydroxypropanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]-3-hydroxypropanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18242813 |
| Molecular Formula | C19H34N8O9 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 5-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]-3-hydroxypropanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(CO)NC(=O)C(CCC(=O)O)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C19H34N8O9/c20-9(2-1-7-24-19(22)23)15(32)25-10(4-6-14(30)31)16(33)27-12(8-28)17(34)26-11(18(35)36)3-5-13(21)29/h9-12,28H,1-8,20H2,(H2,21,29)(H,25,32)(H,26,34)(H,27,33)(H,30,31)(H,35,36)(H4,22,23,24) |
| InChIKey | KGLGIJOGABVAST-UHFFFAOYSA-N |
| XLogP | -4.97 |
| TPSA | 315.64 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | -4.97 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|