C22H41N11O8 — CID 18478784
5-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoic acid (PubChem CID 18478784) has the molecular formula C22H41N11O8 and a molecular weight of 587.64 g/mol. Its IUPAC name is 5-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoic acid.
| Compound Name | 5-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18478784 |
| Molecular Formula | C22H41N11O8 |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | 5-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)NC(CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C22H41N11O8/c23-11(5-7-15(24)34)17(37)31-13(6-8-16(35)36)19(39)32-12(3-1-9-29-21(25)26)18(38)33-14(20(40)41)4-2-10-30-22(27)28/h11-14H,1-10,23H2,(H2,24,34)(H,31,37)(H,32,39)(H,33,38)(H,35,36)(H,40,41)(H4,25,26,29)(H4,27,28,30) |
| InChIKey | QRMFLICGCWYBIJ-UHFFFAOYSA-N |
| XLogP | -4.91 |
| TPSA | 359.81 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | -4.91 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|