C22H41N9O8 — CID 18481180
2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid (PubChem CID 18481180) has the molecular formula C22H41N9O8 and a molecular weight of 559.63 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18481180 |
| Molecular Formula | C22H41N9O8 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
| SMILES | NCCCCC(NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H41N9O8/c23-10-2-1-4-13(29-18(35)12(24)6-8-16(25)32)19(36)30-14(5-3-11-28-22(26)27)20(37)31-15(21(38)39)7-9-17(33)34/h12-15H,1-11,23-24H2,(H2,25,32)(H,29,35)(H,30,36)(H,31,37)(H,33,34)(H,38,39)(H4,26,27,28) |
| InChIKey | LQMNRKADDYSSEC-UHFFFAOYSA-N |
| XLogP | -3.83 |
| TPSA | 321.43 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|