C20H34N8O10 — CID 18478786
2-[[2-[[4-carboxy-2-[(2,5-diamino-5-oxopentanoyl)amino]butanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid (PubChem CID 18478786) has the molecular formula C20H34N8O10 and a molecular weight of 546.54 g/mol. Its IUPAC name is 2-[[2-[[4-carboxy-2-[(2,5-diamino-5-oxopentanoyl)amino]butanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[4-carboxy-2-[(2,5-diamino-5-oxopentanoyl)amino]butanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18478786 |
| Molecular Formula | C20H34N8O10 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 2-[[2-[[4-carboxy-2-[(2,5-diamino-5-oxopentanoyl)amino]butanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
| SMILES | NC(=O)CCC(N)C(=O)NC(CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H34N8O10/c21-9(3-5-13(22)29)16(34)26-11(4-6-14(30)31)18(36)27-10(2-1-7-25-20(23)24)17(35)28-12(19(37)38)8-15(32)33/h9-12H,1-8,21H2,(H2,22,29)(H,26,34)(H,27,36)(H,28,35)(H,30,31)(H,32,33)(H,37,38)(H4,23,24,25) |
| InChIKey | WXRFTIKLAITESA-UHFFFAOYSA-N |
| XLogP | -4.49 |
| TPSA | 332.71 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | -4.49 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|