C19H33N9O9 — CID 18242968
4-amino-2-[[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoic acid (PubChem CID 18242968) has the molecular formula C19H33N9O9 and a molecular weight of 531.53 g/mol. Its IUPAC name is 4-amino-2-[[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18242968 |
| Molecular Formula | C19H33N9O9 |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 4-amino-2-[[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C19H33N9O9/c20-8(2-1-5-25-19(23)24)15(33)26-9(3-4-12(21)29)16(34)27-10(7-14(31)32)17(35)28-11(18(36)37)6-13(22)30/h8-11H,1-7,20H2,(H2,21,29)(H2,22,30)(H,26,33)(H,27,34)(H,28,35)(H,31,32)(H,36,37)(H4,23,24,25) |
| InChIKey | SKTUBZCNYCHXOZ-UHFFFAOYSA-N |
| XLogP | -5.48 |
| TPSA | 338.50 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | -5.48 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|