C20H37N11O8 — CID 18240959
2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid (PubChem CID 18240959) has the molecular formula C20H37N11O8 and a molecular weight of 559.59 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid.
| Compound Name | 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18240959 |
| Molecular Formula | C20H37N11O8 |
| Molecular Weight | 559.59 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid |
| SMILES | NC(=O)CC(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H37N11O8/c21-9(3-1-5-27-19(23)24)15(35)29-10(4-2-6-28-20(25)26)16(36)30-11(7-13(22)32)17(37)31-12(18(38)39)8-14(33)34/h9-12H,1-8,21H2,(H2,22,32)(H,29,35)(H,30,36)(H,31,37)(H,33,34)(H,38,39)(H4,23,24,27)(H4,25,26,28) |
| InChIKey | HNJRKWBLBYKXQH-UHFFFAOYSA-N |
| XLogP | -5.69 |
| TPSA | 359.81 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.59 |
| LogP ≤ 5 | -5.69 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|