C20H37N9O8 — CID 18303166
2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18303166) has the molecular formula C20H37N9O8 and a molecular weight of 531.57 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18303166 |
| Molecular Formula | C20H37N9O8 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | 2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CC(N)=O)C(=O)NC(CC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H37N9O8/c21-6-2-1-4-10(22)16(33)28-12(8-14(23)30)17(34)29-13(9-15(31)32)18(35)27-11(19(36)37)5-3-7-26-20(24)25/h10-13H,1-9,21-22H2,(H2,23,30)(H,27,35)(H,28,33)(H,29,34)(H,31,32)(H,36,37)(H4,24,25,26) |
| InChIKey | HJEIVGHUEFQUOM-UHFFFAOYSA-N |
| XLogP | -4.61 |
| TPSA | 321.43 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | -4.61 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|