C22H44N10O6 — CID 18306703
2-[[4-amino-2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18306703) has the molecular formula C22H44N10O6 and a molecular weight of 544.66 g/mol. Its IUPAC name is 2-[[4-amino-2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[4-amino-2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18306703 |
| Molecular Formula | C22H44N10O6 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | 2-[[4-amino-2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCCCN)C(=O)NC(CC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C22H44N10O6/c23-9-3-1-6-13(25)18(34)30-14(7-2-4-10-24)19(35)32-16(12-17(26)33)20(36)31-15(21(37)38)8-5-11-29-22(27)28/h13-16H,1-12,23-25H2,(H2,26,33)(H,30,34)(H,31,36)(H,32,35)(H,37,38)(H4,27,28,29) |
| InChIKey | ZVWHJEPFIDTDHN-UHFFFAOYSA-N |
| XLogP | -3.96 |
| TPSA | 310.15 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | -3.96 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|